C25H31N5O4P+ — CID 90347665
3-[[2-ethyl-4-[5-(2-ethyl-3-phenyl-3,4-dihydropyrazol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90347665) has the molecular formula C25H31N5O4P+ and a molecular weight of 496.53 g/mol. Its IUPAC name is 3-[[2-ethyl-4-[5-(2-ethyl-3-phenyl-3,4-dihydropyrazol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[2-ethyl-4-[5-(2-ethyl-3-phenyl-3,4-dihydropyrazol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90347665 |
| Molecular Formula | C25H31N5O4P+ |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 3-[[2-ethyl-4-[5-(2-ethyl-3-phenyl-3,4-dihydropyrazol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | CCc1cc(-c2noc(C3=NN(CC)C(c4ccccc4)C3)n2)ccc1CNCCCO[P+](=O)O |
| InChI | InChI=1S/C25H30N5O4P/c1-3-18-15-20(11-12-21(18)17-26-13-8-14-33-35(31)32)24-27-25(34-29-24)22-16-23(30(4-2)28-22)19-9-6-5-7-10-19/h5-7,9-12,15,23,26H,3-4,8,13-14,16-17H2,1-2H3/p+1 |
| InChIKey | ADYDZUUUIMEVAS-UHFFFAOYSA-O |
| XLogP | 4.62 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|