C20H18FIN4O3 — CID 90347985
N-[7-[(2R,3R,4R,5S)-3-fluoro-5-formyl-3,4-dimethyloxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]benzamide (PubChem CID 90347985) has the molecular formula C20H18FIN4O3 and a molecular weight of 508.29 g/mol. Its IUPAC name is N-[7-[(2R,3R,4R,5S)-3-fluoro-5-formyl-3,4-dimethyloxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]benzamide.
| Compound Name | N-[7-[(2R,3R,4R,5S)-3-fluoro-5-formyl-3,4-dimethyloxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 90347985 |
| Molecular Formula | C20H18FIN4O3 |
| Molecular Weight | 508.29 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | N-[7-[(2R,3R,4R,5S)-3-fluoro-5-formyl-3,4-dimethyloxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]benzamide |
| SMILES | C[C@@H]1[C@@H](C=O)O[C@@H](n2cc(I)c3c(NC(=O)c4ccccc4)ncnc32)[C@]1(C)F |
| InChI | InChI=1S/C20H18FIN4O3/c1-11-14(9-27)29-19(20(11,2)21)26-8-13(22)15-16(23-10-24-17(15)26)25-18(28)12-6-4-3-5-7-12/h3-11,14,19H,1-2H3,(H,23,24,25,28)/t11-,14-,19-,20-/m1/s1 |
| InChIKey | RYCDGBVACCMJRR-VKUYIICUSA-N |
| XLogP | 3.75 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|