C21H30N2O9 — CID 90352919
methyl (2S)-2-[acetyloxymethyl(methoxycarbonyl)amino]-4-[[(2S)-1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]butanoate (PubChem CID 90352919) has the molecular formula C21H30N2O9 and a molecular weight of 454.48 g/mol. Its IUPAC name is methyl (2S)-2-[acetyloxymethyl(methoxycarbonyl)amino]-4-[[(2S)-1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]butanoate.
| Compound Name | methyl (2S)-2-[acetyloxymethyl(methoxycarbonyl)amino]-4-[[(2S)-1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 90352919 |
| Molecular Formula | C21H30N2O9 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | methyl (2S)-2-[acetyloxymethyl(methoxycarbonyl)amino]-4-[[(2S)-1-ethoxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]butanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(O)cc1)NCC[C@@H](C(=O)OC)N(COC(C)=O)C(=O)OC |
| InChI | InChI=1S/C21H30N2O9/c1-5-31-19(26)17(12-15-6-8-16(25)9-7-15)22-11-10-18(20(27)29-3)23(21(28)30-4)13-32-14(2)24/h6-9,17-18,22,25H,5,10-13H2,1-4H3/t17-,18-/m0/s1 |
| InChIKey | RZEQOPXJUBZGLM-ROUUACIJSA-N |
| XLogP | 0.98 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|