C28H32FN5O3 — CID 90355648
tert-butyl 4-[3-[amino-(4-fluorophenyl)carbamoyl]-8-cyclopropylisoquinolin-7-yl]piperazine-1-carboxylate (PubChem CID 90355648) has the molecular formula C28H32FN5O3 and a molecular weight of 505.59 g/mol. Its IUPAC name is tert-butyl 4-[3-[amino-(4-fluorophenyl)carbamoyl]-8-cyclopropylisoquinolin-7-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[amino-(4-fluorophenyl)carbamoyl]-8-cyclopropylisoquinolin-7-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90355648 |
| Molecular Formula | C28H32FN5O3 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | tert-butyl 4-[3-[amino-(4-fluorophenyl)carbamoyl]-8-cyclopropylisoquinolin-7-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3cc(C(=O)N(N)c4ccc(F)cc4)ncc3c2C2CC2)CC1 |
| InChI | InChI=1S/C28H32FN5O3/c1-28(2,3)37-27(36)33-14-12-32(13-15-33)24-11-6-19-16-23(31-17-22(19)25(24)18-4-5-18)26(35)34(30)21-9-7-20(29)8-10-21/h6-11,16-18H,4-5,12-15,30H2,1-3H3 |
| InChIKey | DCQDOCUDSIRQPB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|