C29H33FN4O3 — CID 158628491
tert-butyl 4-[3-[2-(2-amino-4-fluorophenyl)acetyl]-8-cyclopropylisoquinolin-7-yl]piperazine-1-carboxylate (PubChem CID 158628491) has the molecular formula C29H33FN4O3 and a molecular weight of 504.61 g/mol. Its IUPAC name is tert-butyl 4-[3-[2-(2-amino-4-fluorophenyl)acetyl]-8-cyclopropylisoquinolin-7-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[2-(2-amino-4-fluorophenyl)acetyl]-8-cyclopropylisoquinolin-7-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 158628491 |
| Molecular Formula | C29H33FN4O3 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | tert-butyl 4-[3-[2-(2-amino-4-fluorophenyl)acetyl]-8-cyclopropylisoquinolin-7-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3cc(C(=O)Cc4ccc(F)cc4N)ncc3c2C2CC2)CC1 |
| InChI | InChI=1S/C29H33FN4O3/c1-29(2,3)37-28(36)34-12-10-33(11-13-34)25-9-7-19-14-24(32-17-22(19)27(25)18-4-5-18)26(35)15-20-6-8-21(30)16-23(20)31/h6-9,14,16-18H,4-5,10-13,15,31H2,1-3H3 |
| InChIKey | QZZMJOXPCKIREF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|