C36H33N9O3S — CID 90364086
(E)-N-[3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide (PubChem CID 90364086) has the molecular formula C36H33N9O3S and a molecular weight of 671.79 g/mol. Its IUPAC name is (E)-N-[3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 90364086 |
| Molecular Formula | C36H33N9O3S |
| Molecular Weight | 671.79 g/mol |
| Exact Mass | 671.24 |
| IUPAC Name | (E)-N-[3-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCCNC(=O)/C(C#N)=C/c1ccc3cc(N4CCN(C)CC4)ccc3c1)OCO2 |
| InChI | InChI=1S/C36H33N9O3S/c1-3-24-18-29-30(48-22-47-29)19-31(24)49-36-42-32-33(38)40-21-41-34(32)45(36)10-4-9-39-35(46)27(20-37)16-23-5-6-26-17-28(8-7-25(26)15-23)44-13-11-43(2)12-14-44/h1,5-8,15-19,21H,4,9-14,22H2,2H3,(H,39,46)(H2,38,40,41)/b27-16+ |
| InChIKey | YRYXWTAWVSDNPP-JVWAILMASA-N |
| XLogP | 4.29 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|