C19H21NO — CID 90365428
N-[2,7-di(propan-2-yl)fluoren-9-ylidene]hydroxylamine (PubChem CID 90365428) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[2,7-di(propan-2-yl)fluoren-9-ylidene]hydroxylamine.
| Compound Name | N-[2,7-di(propan-2-yl)fluoren-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 90365428 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[2,7-di(propan-2-yl)fluoren-9-ylidene]hydroxylamine |
| SMILES | CC(C)c1ccc2c(c1)C(=NO)c1cc(C(C)C)ccc1-2 |
| InChI | InChI=1S/C19H21NO/c1-11(2)13-5-7-15-16-8-6-14(12(3)4)10-18(16)19(20-21)17(15)9-13/h5-12,21H,1-4H3 |
| InChIKey | BFAOGJIGGHNMGU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|