C18H20O2S — CID 121289541
2,8-di(propan-2-yl)dibenzothiophene 5,5-dioxide (PubChem CID 121289541) has the molecular formula C18H20O2S and a molecular weight of 300.42 g/mol. Its IUPAC name is 2,8-di(propan-2-yl)dibenzothiophene 5,5-dioxide.
| Compound Name | 2,8-di(propan-2-yl)dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 121289541 |
| Molecular Formula | C18H20O2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2,8-di(propan-2-yl)dibenzothiophene 5,5-dioxide |
| SMILES | CC(C)c1ccc2c(c1)-c1cc(C(C)C)ccc1S2(=O)=O |
| InChI | InChI=1S/C18H20O2S/c1-11(2)13-5-7-17-15(9-13)16-10-14(12(3)4)6-8-18(16)21(17,19)20/h5-12H,1-4H3 |
| InChIKey | CYVNUBMOEVRSEZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |