About (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one
(5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one (PubChem CID 90371867) has the molecular formula C23H26Cl2N2O3
and a molecular weight of 449.38 g/mol. Its IUPAC name is (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one.
Molecular Properties
| Compound Name | (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one |
| PubChem CID | 90371867 |
| Molecular Formula | C23H26Cl2N2O3 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one |
| SMILES | CN1C(=O)C(CCN2CCOCC2)O[C@H](c2ccc(Cl)cc2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26Cl2N2O3/c1-26-21(16-2-6-18(24)7-3-16)22(17-4-8-19(25)9-5-17)30-20(23(26)28)10-11-27-12-14-29-15-13-27/h2-9,20-22H,10-15H2,1H3/t20?,21-,22+/m0/s1 |
| InChIKey | ISEMFQGMTRGCLK-JTGIGXABSA-N |
| XLogP | 4.36 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one?
The IUPAC name of (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one (CID 90371867) is (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one.
What is the SMILES notation for (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one?
The canonical SMILES for (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one is CN1C(=O)C(CCN2CCOCC2)O[C@H](c2ccc(Cl)cc2)[C@@H]1c1ccc(Cl)cc1.
What is the InChIKey of (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one?
The InChIKey is ISEMFQGMTRGCLK-JTGIGXABSA-N. The full InChI is InChI=1S/C23H26Cl2N2O3/c1-26-21(16-2-6-18(24)7-3-16)22(17-4-8-19(25)9-5-17)30-20(23(26)28)10-11-27-12-14-29-15-13-27/h2-9,20-22H,10-15H2,1H3/t20?,21-,22+/m0/s1.
What are the key properties of (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one?
(5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one has a molecular weight of 449.38 g/mol, XLogP of 4.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-(2-morpholin-4-ylethyl)morpholin-3-one is sourced from PubChem (CID 90371867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).