C15H23ClN2O2 — CID 90379820
tert-butyl N-[2-(3-chloro-5-methyl-2-pyridinyl)-2-methylpropyl]carbamate (PubChem CID 90379820) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is tert-butyl N-[2-(3-chloro-5-methyl-2-pyridinyl)-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-chloro-5-methyl-2-pyridinyl)-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 90379820 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | tert-butyl N-[2-(3-chloro-5-methyl-2-pyridinyl)-2-methylpropyl]carbamate |
| SMILES | Cc1cnc(C(C)(C)CNC(=O)OC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2O2/c1-10-7-11(16)12(17-8-10)15(5,6)9-18-13(19)20-14(2,3)4/h7-8H,9H2,1-6H3,(H,18,19) |
| InChIKey | QGACWVVBTCSYDG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |