C24H28ClNO4 — CID 90384577
5-[(5-chloro-2-hydroxyphenyl)methylamino]-2-hydroxy-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoic acid (PubChem CID 90384577) has the molecular formula C24H28ClNO4 and a molecular weight of 429.94 g/mol. Its IUPAC name is 5-[(5-chloro-2-hydroxyphenyl)methylamino]-2-hydroxy-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoic acid.
| Compound Name | 5-[(5-chloro-2-hydroxyphenyl)methylamino]-2-hydroxy-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoic acid |
|---|---|
| PubChem CID | 90384577 |
| Molecular Formula | C24H28ClNO4 |
| Molecular Weight | 429.94 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 5-[(5-chloro-2-hydroxyphenyl)methylamino]-2-hydroxy-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)benzoic acid |
| SMILES | CC1(C)C2CCC1(C)C(c1cc(NCc3cc(Cl)ccc3O)cc(C(=O)O)c1O)C2 |
| InChI | InChI=1S/C24H28ClNO4/c1-23(2)14-6-7-24(23,3)19(9-14)17-10-16(11-18(21(17)28)22(29)30)26-12-13-8-15(25)4-5-20(13)27/h4-5,8,10-11,14,19,26-28H,6-7,9,12H2,1-3H3,(H,29,30) |
| InChIKey | SQMYHMLRTMTBNQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.94 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|