C14H24O7S — CID 90395010
2-[8-(2-methylprop-2-enoyloxy)octoxy]-2-oxoethanesulfonic acid (PubChem CID 90395010) has the molecular formula C14H24O7S and a molecular weight of 336.41 g/mol. Its IUPAC name is 2-[8-(2-methylprop-2-enoyloxy)octoxy]-2-oxoethanesulfonic acid.
| Compound Name | 2-[8-(2-methylprop-2-enoyloxy)octoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 90395010 |
| Molecular Formula | C14H24O7S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[8-(2-methylprop-2-enoyloxy)octoxy]-2-oxoethanesulfonic acid |
| SMILES | C=C(C)C(=O)OCCCCCCCCOC(=O)CS(=O)(=O)O |
| InChI | InChI=1S/C14H24O7S/c1-12(2)14(16)21-10-8-6-4-3-5-7-9-20-13(15)11-22(17,18)19/h1,3-11H2,2H3,(H,17,18,19) |
| InChIKey | JXJMBGBMZKZMNQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|