C12H14BClN2O4 — CID 90395211
CID 90395211 (PubChem CID 90395211) has the molecular formula C12H14BClN2O4 and a molecular weight of 296.52 g/mol.
| Compound Name | CID 90395211 |
|---|---|
| PubChem CID | 90395211 |
| Molecular Formula | C12H14BClN2O4 |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)[C@H](CNC(=O)c1ccc(C)c(C)c1Cl)ON |
| InChI | InChI=1S/C12H14BClN2O4/c1-6-3-4-8(10(14)7(6)2)11(17)16-5-9(20-15)12(18)19-13/h3-4,9H,5,15H2,1-2H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | LBIKHCPPUKLDMP-VIFPVBQESA-N |
| XLogP | 0.57 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|