C17H25ClO4S — CID 90395527
2-[(3-tert-butyl-2-chloro-6-methylsulfonylphenyl)methoxymethyl]oxolane (PubChem CID 90395527) has the molecular formula C17H25ClO4S and a molecular weight of 360.90 g/mol. Its IUPAC name is 2-[(3-tert-butyl-2-chloro-6-methylsulfonylphenyl)methoxymethyl]oxolane.
| Compound Name | 2-[(3-tert-butyl-2-chloro-6-methylsulfonylphenyl)methoxymethyl]oxolane |
|---|---|
| PubChem CID | 90395527 |
| Molecular Formula | C17H25ClO4S |
| Molecular Weight | 360.90 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-[(3-tert-butyl-2-chloro-6-methylsulfonylphenyl)methoxymethyl]oxolane |
| SMILES | CC(C)(C)c1ccc(S(C)(=O)=O)c(COCC2CCCO2)c1Cl |
| InChI | InChI=1S/C17H25ClO4S/c1-17(2,3)14-7-8-15(23(4,19)20)13(16(14)18)11-21-10-12-6-5-9-22-12/h7-8,12H,5-6,9-11H2,1-4H3 |
| InChIKey | DDOAAZDBHNUGHL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |