C21H25N7O2 — CID 90398874
[2-[1-[6-[3-(3-methyl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]pyrimidin-4-yl]ethenyl]-4-propan-2-yloxyphenyl]hydrazine (PubChem CID 90398874) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is [2-[1-[6-[3-(3-methyl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]pyrimidin-4-yl]ethenyl]-4-propan-2-yloxyphenyl]hydrazine.
| Compound Name | [2-[1-[6-[3-(3-methyl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]pyrimidin-4-yl]ethenyl]-4-propan-2-yloxyphenyl]hydrazine |
|---|---|
| PubChem CID | 90398874 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [2-[1-[6-[3-(3-methyl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]pyrimidin-4-yl]ethenyl]-4-propan-2-yloxyphenyl]hydrazine |
| SMILES | C=C(c1cc(N2CC(c3nc(C)no3)C2)ncn1)c1cc(OC(C)C)ccc1NN |
| InChI | InChI=1S/C21H25N7O2/c1-12(2)29-16-5-6-18(26-22)17(7-16)13(3)19-8-20(24-11-23-19)28-9-15(10-28)21-25-14(4)27-30-21/h5-8,11-12,15,26H,3,9-10,22H2,1-2,4H3 |
| InChIKey | JURXQASYBPYJLK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|