C22H27N4O3S+ — CID 90401805
1-[2-[(2-amino-3-benzyl-2,3-dihydro-1H-inden-5-yl)oxy]ethyl]-1-methylimidazol-1-ium-2-sulfonamide (PubChem CID 90401805) has the molecular formula C22H27N4O3S+ and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-[2-[(2-amino-3-benzyl-2,3-dihydro-1H-inden-5-yl)oxy]ethyl]-1-methylimidazol-1-ium-2-sulfonamide.
| Compound Name | 1-[2-[(2-amino-3-benzyl-2,3-dihydro-1H-inden-5-yl)oxy]ethyl]-1-methylimidazol-1-ium-2-sulfonamide |
|---|---|
| PubChem CID | 90401805 |
| Molecular Formula | C22H27N4O3S+ |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1-[2-[(2-amino-3-benzyl-2,3-dihydro-1H-inden-5-yl)oxy]ethyl]-1-methylimidazol-1-ium-2-sulfonamide |
| SMILES | C[N+]1(CCOc2ccc3c(c2)C(Cc2ccccc2)C(N)C3)C=CN=C1S(N)(=O)=O |
| InChI | InChI=1S/C22H27N4O3S/c1-26(10-9-25-22(26)30(24,27)28)11-12-29-18-8-7-17-14-21(23)20(19(17)15-18)13-16-5-3-2-4-6-16/h2-10,15,20-21H,11-14,23H2,1H3,(H2,24,27,28)/q+1 |
| InChIKey | GADPQYVAXGLXMI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|