C16H16BClN2O4 — CID 90432347
[3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid (PubChem CID 90432347) has the molecular formula C16H16BClN2O4 and a molecular weight of 346.58 g/mol. Its IUPAC name is [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid.
| Compound Name | [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 90432347 |
| Molecular Formula | C16H16BClN2O4 |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid |
| SMILES | Cc1cc(C)cc(C(=O)NNC(=O)c2ccc(B(O)O)cc2Cl)c1 |
| InChI | InChI=1S/C16H16BClN2O4/c1-9-5-10(2)7-11(6-9)15(21)19-20-16(22)13-4-3-12(17(23)24)8-14(13)18/h3-8,23-24H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | SHVPVAMSVTXFAB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|