About [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid
[3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid (PubChem CID 90432347) has the molecular formula C16H16BClN2O4
and a molecular weight of 346.58 g/mol. Its IUPAC name is [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid.
Molecular Properties
| Compound Name | [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid |
| PubChem CID | 90432347 |
| Molecular Formula | C16H16BClN2O4 |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid |
| SMILES | Cc1cc(C)cc(C(=O)NNC(=O)c2ccc(B(O)O)cc2Cl)c1 |
| InChI | InChI=1S/C16H16BClN2O4/c1-9-5-10(2)7-11(6-9)15(21)19-20-16(22)13-4-3-12(17(23)24)8-14(13)18/h3-8,23-24H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | SHVPVAMSVTXFAB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid?
The IUPAC name of [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid (CID 90432347) is [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid.
What is the SMILES notation for [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid?
The canonical SMILES for [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid is Cc1cc(C)cc(C(=O)NNC(=O)c2ccc(B(O)O)cc2Cl)c1.
What is the InChIKey of [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid?
The InChIKey is SHVPVAMSVTXFAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BClN2O4/c1-9-5-10(2)7-11(6-9)15(21)19-20-16(22)13-4-3-12(17(23)24)8-14(13)18/h3-8,23-24H,1-2H3,(H,19,21)(H,20,22).
What are the key properties of [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid?
[3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid has a molecular weight of 346.58 g/mol, XLogP of 0.71, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-4-[[(3,5-dimethylbenzoyl)amino]carbamoyl]phenyl]boronic acid is sourced from PubChem (CID 90432347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).