C26H23N3OS — CID 90452941
(3Z)-5-(2-cyclohexyl-1,3-thiazol-4-yl)-3-(1H-indol-2-ylmethylidene)-1H-indol-2-one (PubChem CID 90452941) has the molecular formula C26H23N3OS and a molecular weight of 425.56 g/mol. Its IUPAC name is (3Z)-5-(2-cyclohexyl-1,3-thiazol-4-yl)-3-(1H-indol-2-ylmethylidene)-1H-indol-2-one.
| Compound Name | (3Z)-5-(2-cyclohexyl-1,3-thiazol-4-yl)-3-(1H-indol-2-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 90452941 |
| Molecular Formula | C26H23N3OS |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (3Z)-5-(2-cyclohexyl-1,3-thiazol-4-yl)-3-(1H-indol-2-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(-c3csc(C4CCCCC4)n3)cc2/C1=C/c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H23N3OS/c30-25-21(14-19-12-17-8-4-5-9-22(17)27-19)20-13-18(10-11-23(20)28-25)24-15-31-26(29-24)16-6-2-1-3-7-16/h4-5,8-16,27H,1-3,6-7H2,(H,28,30)/b21-14- |
| InChIKey | LEDYAYPUQZJAHN-STZFKDTASA-N |
| XLogP | 6.83 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|