About 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one
4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one (PubChem CID 90459585) has the molecular formula C27H25FN2O3
and a molecular weight of 444.51 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one.
Molecular Properties
| Compound Name | 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one |
| PubChem CID | 90459585 |
| Molecular Formula | C27H25FN2O3 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one |
| SMILES | COc1ccc(Cn2c(=O)ccc3c4c5ccccc5n(CCCF)c4ccc32)c(OC)c1 |
| InChI | InChI=1S/C27H25FN2O3/c1-32-19-9-8-18(25(16-19)33-2)17-30-23-11-12-24-27(21(23)10-13-26(30)31)20-6-3-4-7-22(20)29(24)15-5-14-28/h3-4,6-13,16H,5,14-15,17H2,1-2H3 |
| InChIKey | NSZIDVLSFDPDMK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 45.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one?
The IUPAC name of 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one (CID 90459585) is 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one.
What is the SMILES notation for 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one?
The canonical SMILES for 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one is COc1ccc(Cn2c(=O)ccc3c4c5ccccc5n(CCCF)c4ccc32)c(OC)c1.
What is the InChIKey of 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one?
The InChIKey is NSZIDVLSFDPDMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25FN2O3/c1-32-19-9-8-18(25(16-19)33-2)17-30-23-11-12-24-27(21(23)10-13-26(30)31)20-6-3-4-7-22(20)29(24)15-5-14-28/h3-4,6-13,16H,5,14-15,17H2,1-2H3.
What are the key properties of 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one?
4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one has a molecular weight of 444.51 g/mol, XLogP of 5.53, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dimethoxyphenyl)methyl]-7-(3-fluoropropyl)pyrido[2,3-c]carbazol-3-one is sourced from PubChem (CID 90459585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).