C29H30OS4 — CID 90464303
2-[2-hexoxy-5-methyl-4-(5-thiophen-2-ylthiophen-2-yl)cyclohexa-1,3-dien-1-yl]-5-thiophen-2-ylthiophene (PubChem CID 90464303) has the molecular formula C29H30OS4 and a molecular weight of 522.83 g/mol. Its IUPAC name is 2-[2-hexoxy-5-methyl-4-(5-thiophen-2-ylthiophen-2-yl)cyclohexa-1,3-dien-1-yl]-5-thiophen-2-ylthiophene.
| Compound Name | 2-[2-hexoxy-5-methyl-4-(5-thiophen-2-ylthiophen-2-yl)cyclohexa-1,3-dien-1-yl]-5-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 90464303 |
| Molecular Formula | C29H30OS4 |
| Molecular Weight | 522.83 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 2-[2-hexoxy-5-methyl-4-(5-thiophen-2-ylthiophen-2-yl)cyclohexa-1,3-dien-1-yl]-5-thiophen-2-ylthiophene |
| SMILES | CCCCCCOC1=C(c2ccc(-c3cccs3)s2)CC(C)C(c2ccc(-c3cccs3)s2)=C1 |
| InChI | InChI=1S/C29H30OS4/c1-3-4-5-6-15-30-23-19-21(24-11-13-28(33-24)26-9-7-16-31-26)20(2)18-22(23)25-12-14-29(34-25)27-10-8-17-32-27/h7-14,16-17,19-20H,3-6,15,18H2,1-2H3 |
| InChIKey | ICZVSCTYTXOBPU-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.83 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|