C14H16O4 — CID 90470383
(1R,2R,6E)-7-methyl-3-methylidene-5,13-dioxatricyclo[9.2.1.02,6]tetradec-6-ene-4,12-dione (PubChem CID 90470383) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (1R,2R,6E)-7-methyl-3-methylidene-5,13-dioxatricyclo[9.2.1.02,6]tetradec-6-ene-4,12-dione.
| Compound Name | (1R,2R,6E)-7-methyl-3-methylidene-5,13-dioxatricyclo[9.2.1.02,6]tetradec-6-ene-4,12-dione |
|---|---|
| PubChem CID | 90470383 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (1R,2R,6E)-7-methyl-3-methylidene-5,13-dioxatricyclo[9.2.1.02,6]tetradec-6-ene-4,12-dione |
| SMILES | C=C1C(=O)O/C2=C(\C)CCCC3C[C@@H](OC3=O)[C@@H]12 |
| InChI | InChI=1S/C14H16O4/c1-7-4-3-5-9-6-10(17-14(9)16)11-8(2)13(15)18-12(7)11/h9-11H,2-6H2,1H3/b12-7+/t9?,10-,11-/m1/s1 |
| InChIKey | HFHIBIJURZAPKH-PSQWLAILSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|