C11H16O2 — CID 90471602
2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane-1-carboxylic acid (PubChem CID 90471602) has the molecular formula C11H16O2 and a molecular weight of 195.34 g/mol. Its IUPAC name is 2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane-1-carboxylic acid.
| Compound Name | 2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 90471602 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 195.34 g/mol |
| Exact Mass | 195.21 |
| IUPAC Name | 2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantane-1-carboxylic acid |
| SMILES | [2H]C1([2H])C2([2H])C([2H])([2H])C3([2H])C([2H])([2H])C1([2H])C([2H])([2H])C(C(=O)O)(C2([2H])[2H])C3([2H])[2H] |
| InChI | InChI=1S/C11H16O2/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H,12,13)/i1D2,2D2,3D2,4D2,5D2,6D2,7D,8D,9D |
| InChIKey | JIMXXGFJRDUSRO-BXSQCBKHSA-N |
| XLogP | 2.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |