C9H8O3 — CID 90477299
2,3-dihydrocyclohepta[b][1,4]dioxin-5-one (PubChem CID 90477299) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is 2,3-dihydrocyclohepta[b][1,4]dioxin-5-one.
| Compound Name | 2,3-dihydrocyclohepta[b][1,4]dioxin-5-one |
|---|---|
| PubChem CID | 90477299 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 2,3-dihydrocyclohepta[b][1,4]dioxin-5-one |
| SMILES | O=c1ccccc2c1OCCO2 |
| InChI | InChI=1S/C9H8O3/c10-7-3-1-2-4-8-9(7)12-6-5-11-8/h1-4H,5-6H2 |
| InChIKey | IVPDRLRRHRICJL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |