C12H15BrClNO2 — CID 90483081
1-(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)-N-methylmethanamine;hydrochloride (PubChem CID 90483081) has the molecular formula C12H15BrClNO2 and a molecular weight of 320.61 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)-N-methylmethanamine;hydrochloride.
| Compound Name | 1-(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 90483081 |
| Molecular Formula | C12H15BrClNO2 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 1-(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)-N-methylmethanamine;hydrochloride |
| SMILES | C#CCOc1cc(Br)c(CNC)cc1OC.Cl |
| InChI | InChI=1S/C12H14BrNO2.ClH/c1-4-5-16-12-7-10(13)9(8-14-2)6-11(12)15-3;/h1,6-7,14H,5,8H2,2-3H3;1H |
| InChIKey | JYIXHKCWZHRWOY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|