C14H18N2O3S2 — CID 90513272
1-cyclopropylsulfonyl-N-(4-methylsulfanylphenyl)azetidine-3-carboxamide (PubChem CID 90513272) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-N-(4-methylsulfanylphenyl)azetidine-3-carboxamide.
| Compound Name | 1-cyclopropylsulfonyl-N-(4-methylsulfanylphenyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90513272 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 1-cyclopropylsulfonyl-N-(4-methylsulfanylphenyl)azetidine-3-carboxamide |
| SMILES | CSc1ccc(NC(=O)C2CN(S(=O)(=O)C3CC3)C2)cc1 |
| InChI | InChI=1S/C14H18N2O3S2/c1-20-12-4-2-11(3-5-12)15-14(17)10-8-16(9-10)21(18,19)13-6-7-13/h2-5,10,13H,6-9H2,1H3,(H,15,17) |
| InChIKey | JRALTOXQGZCDNS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |