C29H37N5O2 — CID 90545630
N-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-2-(2-tert-butyl-4-methylphenoxy)propanamide (PubChem CID 90545630) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-2-(2-tert-butyl-4-methylphenoxy)propanamide.
| Compound Name | N-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-2-(2-tert-butyl-4-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 90545630 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | N-[6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-2-(2-tert-butyl-4-methylphenoxy)propanamide |
| SMILES | Cc1ccc(OC(C)C(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H37N5O2/c1-21-11-12-25(24(17-21)29(3,4)5)36-22(2)28(35)32-26-18-27(31-20-30-26)34-15-13-33(14-16-34)19-23-9-7-6-8-10-23/h6-12,17-18,20,22H,13-16,19H2,1-5H3,(H,30,31,32,35) |
| InChIKey | AFODMAWJCBNGJH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |