C18H15NO3 — CID 90549391
(E)-N-[3-(4-acetylphenyl)prop-2-ynyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 90549391) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is (E)-N-[3-(4-acetylphenyl)prop-2-ynyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-(4-acetylphenyl)prop-2-ynyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 90549391 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (E)-N-[3-(4-acetylphenyl)prop-2-ynyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | CC(=O)c1ccc(C#CCNC(=O)/C=C/c2ccco2)cc1 |
| InChI | InChI=1S/C18H15NO3/c1-14(20)16-8-6-15(7-9-16)4-2-12-19-18(21)11-10-17-5-3-13-22-17/h3,5-11,13H,12H2,1H3,(H,19,21)/b11-10+ |
| InChIKey | KCQVRXSHWWSVTG-ZHACJKMWSA-N |
| XLogP | 2.66 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|