C20H23N7O3 — CID 90557531
butyl 4-[[1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)azetidine-3-carbonyl]amino]benzoate (PubChem CID 90557531) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is butyl 4-[[1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)azetidine-3-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)azetidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 90557531 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | butyl 4-[[1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)azetidine-3-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2CN(c3ncnc4c3nnn4C)C2)cc1 |
| InChI | InChI=1S/C20H23N7O3/c1-3-4-9-30-20(29)13-5-7-15(8-6-13)23-19(28)14-10-27(11-14)18-16-17(21-12-22-18)26(2)25-24-16/h5-8,12,14H,3-4,9-11H2,1-2H3,(H,23,28) |
| InChIKey | RQDQCYYZYWHKNW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|