C16H15BrN2O3 — CID 90576628
N-[4-(3-bromophenoxy)but-2-ynyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 90576628) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is N-[4-(3-bromophenoxy)but-2-ynyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[4-(3-bromophenoxy)but-2-ynyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90576628 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | N-[4-(3-bromophenoxy)but-2-ynyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)NCC#CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C16H15BrN2O3/c1-11-15(12(2)22-19-11)16(20)18-8-3-4-9-21-14-7-5-6-13(17)10-14/h5-7,10H,8-9H2,1-2H3,(H,18,20) |
| InChIKey | CNUQBMKZHJICOK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|