About N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide
N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide (PubChem CID 90606101) has the molecular formula C22H29N3OS
and a molecular weight of 383.56 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide |
| PubChem CID | 90606101 |
| Molecular Formula | C22H29N3OS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide |
| SMILES | Cc1ccc(C)c2sc(N(C)CC(=O)NC34CC5CC(CC(C5)C3)C4)nc12 |
| InChI | InChI=1S/C22H29N3OS/c1-13-4-5-14(2)20-19(13)23-21(27-20)25(3)12-18(26)24-22-9-15-6-16(10-22)8-17(7-15)11-22/h4-5,15-17H,6-12H2,1-3H3,(H,24,26) |
| InChIKey | NTNMUTHZPMNRFZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide?
The IUPAC name of N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide (CID 90606101) is N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide.
What is the SMILES notation for N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide?
The canonical SMILES for N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide is Cc1ccc(C)c2sc(N(C)CC(=O)NC34CC5CC(CC(C5)C3)C4)nc12.
What is the InChIKey of N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide?
The InChIKey is NTNMUTHZPMNRFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3OS/c1-13-4-5-14(2)20-19(13)23-21(27-20)25(3)12-18(26)24-22-9-15-6-16(10-22)8-17(7-15)11-22/h4-5,15-17H,6-12H2,1-3H3,(H,24,26).
What are the key properties of N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide?
N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide has a molecular weight of 383.56 g/mol, XLogP of 4.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)-2-[(4,7-dimethyl-1,3-benzothiazol-2-yl)-methylamino]acetamide is sourced from PubChem (CID 90606101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).