C20H21FN2O5S — CID 90630171
(4,5-dimethoxy-2-nitrophenyl)-[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]methanone (PubChem CID 90630171) has the molecular formula C20H21FN2O5S and a molecular weight of 420.46 g/mol. Its IUPAC name is (4,5-dimethoxy-2-nitrophenyl)-[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]methanone.
| Compound Name | (4,5-dimethoxy-2-nitrophenyl)-[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]methanone |
|---|---|
| PubChem CID | 90630171 |
| Molecular Formula | C20H21FN2O5S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | (4,5-dimethoxy-2-nitrophenyl)-[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCSC(c3ccccc3F)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H21FN2O5S/c1-27-17-11-14(16(23(25)26)12-18(17)28-2)20(24)22-8-7-19(29-10-9-22)13-5-3-4-6-15(13)21/h3-6,11-12,19H,7-10H2,1-2H3 |
| InChIKey | AYXKNRDFNIBTOA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|