C22H26FN3O5 — CID 90634240
(E)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 90634240) has the molecular formula C22H26FN3O5 and a molecular weight of 431.46 g/mol. Its IUPAC name is (E)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90634240 |
| Molecular Formula | C22H26FN3O5 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (E)-N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC2CCC(Oc3ncc(F)cn3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H26FN3O5/c1-28-18-10-14(11-19(29-2)21(18)30-3)4-9-20(27)26-16-5-7-17(8-6-16)31-22-24-12-15(23)13-25-22/h4,9-13,16-17H,5-8H2,1-3H3,(H,26,27)/b9-4+ |
| InChIKey | CTYSCCNKGDYZJP-RUDMXATFSA-N |
| XLogP | 3.16 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|