C13H10Cl3N3O3S — CID 90644504
1-(4-chlorophenyl)-3-(2,4-dichloro-5-sulfamoylphenyl)urea (PubChem CID 90644504) has the molecular formula C13H10Cl3N3O3S and a molecular weight of 394.67 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2,4-dichloro-5-sulfamoylphenyl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(2,4-dichloro-5-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 90644504 |
| Molecular Formula | C13H10Cl3N3O3S |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2,4-dichloro-5-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1cc(NC(=O)Nc2ccc(Cl)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3N3O3S/c14-7-1-3-8(4-2-7)18-13(20)19-11-6-12(23(17,21)22)10(16)5-9(11)15/h1-6H,(H2,17,21,22)(H2,18,19,20) |
| InChIKey | USAVLGKQKOQPNX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |