C11H16ClN3O2 — CID 90644756
1-(1,3-benzodioxol-5-yl)-2-propylguanidine;hydrochloride (PubChem CID 90644756) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-propylguanidine;hydrochloride.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-propylguanidine;hydrochloride |
|---|---|
| PubChem CID | 90644756 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-propylguanidine;hydrochloride |
| SMILES | CCC/N=C(\N)Nc1ccc2c(c1)OCO2.Cl |
| InChI | InChI=1S/C11H15N3O2.ClH/c1-2-5-13-11(12)14-8-3-4-9-10(6-8)16-7-15-9;/h3-4,6H,2,5,7H2,1H3,(H3,12,13,14);1H |
| InChIKey | GPDNQQZURDHKBK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|