C22H25N3O2 — CID 90653743
1-[4-(3-acetyl-2,5-dimethylpyrrol-1-yl)benzoyl]-4-methylpiperidine-4-carbonitrile (PubChem CID 90653743) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-[4-(3-acetyl-2,5-dimethylpyrrol-1-yl)benzoyl]-4-methylpiperidine-4-carbonitrile.
| Compound Name | 1-[4-(3-acetyl-2,5-dimethylpyrrol-1-yl)benzoyl]-4-methylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 90653743 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1-[4-(3-acetyl-2,5-dimethylpyrrol-1-yl)benzoyl]-4-methylpiperidine-4-carbonitrile |
| SMILES | CC(=O)c1cc(C)n(-c2ccc(C(=O)N3CCC(C)(C#N)CC3)cc2)c1C |
| InChI | InChI=1S/C22H25N3O2/c1-15-13-20(17(3)26)16(2)25(15)19-7-5-18(6-8-19)21(27)24-11-9-22(4,14-23)10-12-24/h5-8,13H,9-12H2,1-4H3 |
| InChIKey | JNFMGFXAGFJJIE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|