C21H26N2O2S — CID 91833483
4-(3-acetyl-2,5-dimethylpyrrol-1-yl)-N-methyl-N-(thian-4-yl)benzamide (PubChem CID 91833483) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 4-(3-acetyl-2,5-dimethylpyrrol-1-yl)-N-methyl-N-(thian-4-yl)benzamide.
| Compound Name | 4-(3-acetyl-2,5-dimethylpyrrol-1-yl)-N-methyl-N-(thian-4-yl)benzamide |
|---|---|
| PubChem CID | 91833483 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-(3-acetyl-2,5-dimethylpyrrol-1-yl)-N-methyl-N-(thian-4-yl)benzamide |
| SMILES | CC(=O)c1cc(C)n(-c2ccc(C(=O)N(C)C3CCSCC3)cc2)c1C |
| InChI | InChI=1S/C21H26N2O2S/c1-14-13-20(16(3)24)15(2)23(14)19-7-5-17(6-8-19)21(25)22(4)18-9-11-26-12-10-18/h5-8,13,18H,9-12H2,1-4H3 |
| InChIKey | XTSNSXPWVKGOGA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|