About [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate
[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065816) has the molecular formula C16H15BrN2O3S
and a molecular weight of 395.28 g/mol. Its IUPAC name is [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate.
Molecular Properties
| Compound Name | [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
| PubChem CID | 9065816 |
| Molecular Formula | C16H15BrN2O3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
| SMILES | O=C(COC(=O)C[C@H]1C=CCC1)Nc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C16H15BrN2O3S/c17-11-5-6-12-13(8-11)23-16(18-12)19-14(20)9-22-15(21)7-10-3-1-2-4-10/h1,3,5-6,8,10H,2,4,7,9H2,(H,18,19,20)/t10-/m0/s1 |
| InChIKey | WQZPXKTVGZZRFK-JTQLQIEISA-N |
| XLogP | 3.90 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate?
The IUPAC name of [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate (CID 9065816) is [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate.
What is the SMILES notation for [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate?
The canonical SMILES for [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate is O=C(COC(=O)C[C@H]1C=CCC1)Nc1nc2ccc(Br)cc2s1.
What is the InChIKey of [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate?
The InChIKey is WQZPXKTVGZZRFK-JTQLQIEISA-N. The full InChI is InChI=1S/C16H15BrN2O3S/c17-11-5-6-12-13(8-11)23-16(18-12)19-14(20)9-22-15(21)7-10-3-1-2-4-10/h1,3,5-6,8,10H,2,4,7,9H2,(H,18,19,20)/t10-/m0/s1.
What are the key properties of [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate?
[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate has a molecular weight of 395.28 g/mol, XLogP of 3.90, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate is sourced from PubChem (CID 9065816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).