C16H15BrN2O3S — CID 9065816
[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065816) has the molecular formula C16H15BrN2O3S and a molecular weight of 395.28 g/mol. Its IUPAC name is [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate.
| Compound Name | [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9065816 |
| Molecular Formula | C16H15BrN2O3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | [2-[(6-bromo-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-[(1S)-cyclopent-2-en-1-yl]acetate |
| SMILES | O=C(COC(=O)C[C@H]1C=CCC1)Nc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C16H15BrN2O3S/c17-11-5-6-12-13(8-11)23-16(18-12)19-14(20)9-22-15(21)7-10-3-1-2-4-10/h1,3,5-6,8,10H,2,4,7,9H2,(H,18,19,20)/t10-/m0/s1 |
| InChIKey | WQZPXKTVGZZRFK-JTQLQIEISA-N |
| XLogP | 3.90 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|