C14H27N3O4S2 — CID 90658679
2-[[(2R)-2-azaniumyl-3-[(E)-N-hydroxy-C-(7-methylsulfanylheptyl)carbonimidoyl]sulfanylpropanoyl]amino]acetate (PubChem CID 90658679) has the molecular formula C14H27N3O4S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 2-[[(2R)-2-azaniumyl-3-[(E)-N-hydroxy-C-(7-methylsulfanylheptyl)carbonimidoyl]sulfanylpropanoyl]amino]acetate.
| Compound Name | 2-[[(2R)-2-azaniumyl-3-[(E)-N-hydroxy-C-(7-methylsulfanylheptyl)carbonimidoyl]sulfanylpropanoyl]amino]acetate |
|---|---|
| PubChem CID | 90658679 |
| Molecular Formula | C14H27N3O4S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[[(2R)-2-azaniumyl-3-[(E)-N-hydroxy-C-(7-methylsulfanylheptyl)carbonimidoyl]sulfanylpropanoyl]amino]acetate |
| SMILES | CSCCCCCCC/C(=N\O)SC[C@H]([NH3+])C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C14H27N3O4S2/c1-22-8-6-4-2-3-5-7-12(17-21)23-10-11(15)14(20)16-9-13(18)19/h11,21H,2-10,15H2,1H3,(H,16,20)(H,18,19)/b17-12+/t11-/m0/s1 |
| InChIKey | AFUUQIYPOMVOTN-GBTTUNCCSA-N |
| XLogP | -0.31 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|