C23H33N2O8S- — CID 159585422
2-azaniumyl-8-(carboxylatomethylamino)-7-(methylsulfanylmethyl)-5,8-dioxooctanoate;2-pentylcyclohexa-2,5-diene-1,4-dione (PubChem CID 159585422) has the molecular formula C23H33N2O8S- and a molecular weight of 497.59 g/mol. Its IUPAC name is 2-azaniumyl-8-(carboxylatomethylamino)-7-(methylsulfanylmethyl)-5,8-dioxooctanoate;2-pentylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-azaniumyl-8-(carboxylatomethylamino)-7-(methylsulfanylmethyl)-5,8-dioxooctanoate;2-pentylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 159585422 |
| Molecular Formula | C23H33N2O8S- |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 2-azaniumyl-8-(carboxylatomethylamino)-7-(methylsulfanylmethyl)-5,8-dioxooctanoate;2-pentylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCC1=CC(=O)C=CC1=O.CSCC(CC(=O)CCC([NH3+])C(=O)[O-])C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C12H20N2O6S.C11H14O2/c1-21-6-7(11(18)14-5-10(16)17)4-8(15)2-3-9(13)12(19)20;1-2-3-4-5-9-8-10(12)6-7-11(9)13/h7,9H,2-6,13H2,1H3,(H,14,18)(H,16,17)(H,19,20);6-8H,2-5H2,1H3/p-1 |
| InChIKey | MJNYWEQMOJYIDN-UHFFFAOYSA-M |
| XLogP | -1.87 |
| TPSA | 188.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|