C14H25N2O5S — CID 157010180
CID 157010180 (PubChem CID 157010180) has the molecular formula C14H25N2O5S and a molecular weight of 333.43 g/mol.
| Compound Name | CID 157010180 |
|---|---|
| PubChem CID | 157010180 |
| Molecular Formula | C14H25N2O5S |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | — |
| SMILES | CCCCCC(O)C(CC=O)SCC([NH2+])C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C14H26N2O5S/c1-2-3-4-5-11(18)12(6-7-17)22-9-10(15)14(21)16-8-13(19)20/h7,10-12,18H,2-6,8-9,15H2,1H3,(H,16,21)(H,19,20)/q+1/p-1 |
| InChIKey | QSRMQANNUBNKMX-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|