About aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate
aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate (PubChem CID 90661699) has the molecular formula C14H14AlBN4O2S
and a molecular weight of 340.15 g/mol. Its IUPAC name is aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate.
Molecular Properties
| Compound Name | aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate |
| PubChem CID | 90661699 |
| Molecular Formula | C14H14AlBN4O2S |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate |
| SMILES | C/C(=N\N=C(\N)[S-])c1ccccn1.[Al+3].[O-]B([O-])c1ccccc1 |
| InChI | InChI=1S/C8H10N4S.C6H5BO2.Al/c1-6(11-12-8(9)13)7-4-2-3-5-10-7;8-7(9)6-4-2-1-3-5-6;/h2-5H,1H3,(H3,9,12,13);1-5H;/q;-2;+3/p-1/b11-6+;; |
| InChIKey | YRIMWFAAWBCDGM-QVLKBJGCSA-M |
| XLogP | -1.61 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate?
The IUPAC name of aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate (CID 90661699) is aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate.
What is the SMILES notation for aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate?
The canonical SMILES for aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate is C/C(=N\N=C(\N)[S-])c1ccccn1.[Al+3].[O-]B([O-])c1ccccc1.
What is the InChIKey of aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate?
The InChIKey is YRIMWFAAWBCDGM-QVLKBJGCSA-M. The full InChI is InChI=1S/C8H10N4S.C6H5BO2.Al/c1-6(11-12-8(9)13)7-4-2-3-5-10-7;8-7(9)6-4-2-1-3-5-6;/h2-5H,1H3,(H3,9,12,13);1-5H;/q;-2;+3/p-1/b11-6+;;.
What are the key properties of aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate?
aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate has a molecular weight of 340.15 g/mol, XLogP of -1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;dioxido(phenyl)borane;N'-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate is sourced from PubChem (CID 90661699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).