C31H26N5O10+ — CID 90669251
[(2R,4R,5R,6R)-10-amino-5-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]-3,7-dioxa-9-aza-1-azoniatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-4-yl]methyl 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 90669251) has the molecular formula C31H26N5O10+ and a molecular weight of 628.57 g/mol. Its IUPAC name is [(2R,4R,5R,6R)-10-amino-5-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]-3,7-dioxa-9-aza-1-azoniatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-4-yl]methyl 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [(2R,4R,5R,6R)-10-amino-5-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]-3,7-dioxa-9-aza-1-azoniatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-4-yl]methyl 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 90669251 |
| Molecular Formula | C31H26N5O10+ |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | [(2R,4R,5R,6R)-10-amino-5-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]-3,7-dioxa-9-aza-1-azoniatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-4-yl]methyl 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Nc1cc[n+]2c(n1)O[C@@H]1[C@H](OC(=O)CCN3C(=O)c4ccccc4C3=O)[C@@H](COC(=O)CCN3C(=O)c4ccccc4C3=O)O[C@H]12 |
| InChI | InChI=1S/C31H25N5O10/c32-21-9-12-36-30-25(46-31(36)33-21)24(45-23(38)11-14-35-28(41)18-7-3-4-8-19(18)29(35)42)20(44-30)15-43-22(37)10-13-34-26(39)16-5-1-2-6-17(16)27(34)40/h1-9,12,20,24-25,30,32H,10-11,13-15H2/p+1/t20-,24-,25-,30-/m1/s1 |
| InChIKey | ORAGKHPZPLIXLG-NLMTZWCRSA-O |
| XLogP | 0.44 |
| TPSA | 188.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|