C8H13N5O4 — CID 90673688
2-[(2R,3R,4S,5S)-4-amino-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 90673688) has the molecular formula C8H13N5O4 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S)-4-amino-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 2-[(2R,3R,4S,5S)-4-amino-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 90673688 |
| Molecular Formula | C8H13N5O4 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-[(2R,3R,4S,5S)-4-amino-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncnn1[C@@H]1O[C@H](CO)[C@@H](N)[C@H]1O |
| InChI | InChI=1S/C8H13N5O4/c9-4-3(1-14)17-8(5(4)15)13-7(6(10)16)11-2-12-13/h2-5,8,14-15H,1,9H2,(H2,10,16)/t3-,4-,5-,8-/m1/s1 |
| InChIKey | SKDWPACQWJERKL-AFCXAGJDSA-N |
| XLogP | -3.05 |
| TPSA | 149.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |