C16H21N5O3 — CID 90674275
7,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17),11(16)-tetraene-7-carboximidamide;nitric acid (PubChem CID 90674275) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 7,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17),11(16)-tetraene-7-carboximidamide;nitric acid.
| Compound Name | 7,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17),11(16)-tetraene-7-carboximidamide;nitric acid |
|---|---|
| PubChem CID | 90674275 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 7,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17),11(16)-tetraene-7-carboximidamide;nitric acid |
| SMILES | O=[N+]([O-])O.[H]/N=C(\N)N1CCn2c3c(c4cccc(c42)C1)CCCC3 |
| InChI | InChI=1S/C16H20N4.HNO3/c17-16(18)19-8-9-20-14-7-2-1-5-12(14)13-6-3-4-11(10-19)15(13)20;2-1(3)4/h3-4,6H,1-2,5,7-10H2,(H3,17,18);(H,2,3,4) |
| InChIKey | DJBOHMRZMITEOC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|