C18H26ClNO — CID 90679409
(1R,14S)-4-methoxy-N,N,1-trimethyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,11-tetraen-14-amine;hydrochloride (PubChem CID 90679409) has the molecular formula C18H26ClNO and a molecular weight of 307.87 g/mol. Its IUPAC name is (1R,14S)-4-methoxy-N,N,1-trimethyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,11-tetraen-14-amine;hydrochloride.
| Compound Name | (1R,14S)-4-methoxy-N,N,1-trimethyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,11-tetraen-14-amine;hydrochloride |
|---|---|
| PubChem CID | 90679409 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (1R,14S)-4-methoxy-N,N,1-trimethyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,11-tetraen-14-amine;hydrochloride |
| SMILES | COc1ccc2c(c1)[C@@]1(C)CC=CCC(C2)[C@@H]1N(C)C.Cl |
| InChI | InChI=1S/C18H25NO.ClH/c1-18-10-6-5-7-14(17(18)19(2)3)11-13-8-9-15(20-4)12-16(13)18;/h5-6,8-9,12,14,17H,7,10-11H2,1-4H3;1H/t14?,17-,18+;/m0./s1 |
| InChIKey | CDHGVPYFMPZSJA-HRZYPINMSA-N |
| XLogP | 3.83 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|