C23H26N2O2 — CID 90682883
5-butyl-2-(piperidine-1-carbonyl)phenanthridin-6-one (PubChem CID 90682883) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 5-butyl-2-(piperidine-1-carbonyl)phenanthridin-6-one.
| Compound Name | 5-butyl-2-(piperidine-1-carbonyl)phenanthridin-6-one |
|---|---|
| PubChem CID | 90682883 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 5-butyl-2-(piperidine-1-carbonyl)phenanthridin-6-one |
| SMILES | CCCCn1c(=O)c2ccccc2c2cc(C(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C23H26N2O2/c1-2-3-15-25-21-12-11-17(22(26)24-13-7-4-8-14-24)16-20(21)18-9-5-6-10-19(18)23(25)27/h5-6,9-12,16H,2-4,7-8,13-15H2,1H3 |
| InChIKey | DHSMNHWMUHAQNA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|