C22H30N2O2 — CID 143849927
(9-butyl-5,6,7,8-tetrahydrocarbazol-3-yl)-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 143849927) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is (9-butyl-5,6,7,8-tetrahydrocarbazol-3-yl)-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | (9-butyl-5,6,7,8-tetrahydrocarbazol-3-yl)-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 143849927 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | (9-butyl-5,6,7,8-tetrahydrocarbazol-3-yl)-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | CCCCn1c2c(c3cc(C(=O)N4CCC(O)CC4)ccc31)CCCC2 |
| InChI | InChI=1S/C22H30N2O2/c1-2-3-12-24-20-7-5-4-6-18(20)19-15-16(8-9-21(19)24)22(26)23-13-10-17(25)11-14-23/h8-9,15,17,25H,2-7,10-14H2,1H3 |
| InChIKey | SKFMCICAAPBMRN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|