C13H8FN3O5 — CID 90684676
(2,5-dihydroxypyrrol-1-yl) 4-(cyano-fluoro-nitrosomethyl)benzoate (PubChem CID 90684676) has the molecular formula C13H8FN3O5 and a molecular weight of 305.22 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-(cyano-fluoro-nitrosomethyl)benzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-(cyano-fluoro-nitrosomethyl)benzoate |
|---|---|
| PubChem CID | 90684676 |
| Molecular Formula | C13H8FN3O5 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-(cyano-fluoro-nitrosomethyl)benzoate |
| SMILES | N#CC(F)(N=O)c1ccc(C(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C13H8FN3O5/c14-13(7-15,16-21)9-3-1-8(2-4-9)12(20)22-17-10(18)5-6-11(17)19/h1-6,18-19H |
| InChIKey | YFIFIYRWTBFSQA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 124.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|