C16H27NO3 — CID 90692095
methyl 2-[4-[(1R,2R,3S,5S)-2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]but-2-enoxy]acetate (PubChem CID 90692095) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is methyl 2-[4-[(1R,2R,3S,5S)-2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]but-2-enoxy]acetate.
| Compound Name | methyl 2-[4-[(1R,2R,3S,5S)-2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]but-2-enoxy]acetate |
|---|---|
| PubChem CID | 90692095 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | methyl 2-[4-[(1R,2R,3S,5S)-2-amino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]but-2-enoxy]acetate |
| SMILES | COC(=O)COCC=CC[C@H]1C[C@H]2C[C@@H]([C@@H]1N)C2(C)C |
| InChI | InChI=1S/C16H27NO3/c1-16(2)12-8-11(15(17)13(16)9-12)6-4-5-7-20-10-14(18)19-3/h4-5,11-13,15H,6-10,17H2,1-3H3/t11-,12-,13-,15+/m0/s1 |
| InChIKey | SYLBGFFNBCJYLG-PWNZVWSESA-N |
| XLogP | 2.13 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|