C12H22O — CID 90693729
1-[2-(2,3-dimethylbutyl)-3-methylidenecyclopropyl]ethanol (PubChem CID 90693729) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-[2-(2,3-dimethylbutyl)-3-methylidenecyclopropyl]ethanol.
| Compound Name | 1-[2-(2,3-dimethylbutyl)-3-methylidenecyclopropyl]ethanol |
|---|---|
| PubChem CID | 90693729 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 1-[2-(2,3-dimethylbutyl)-3-methylidenecyclopropyl]ethanol |
| SMILES | C=C1C(CC(C)C(C)C)C1C(C)O |
| InChI | InChI=1S/C12H22O/c1-7(2)8(3)6-11-9(4)12(11)10(5)13/h7-8,10-13H,4,6H2,1-3,5H3 |
| InChIKey | ISICKAQSAYJFAZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|